C34H28N4O2 — CID 174843793
21,22-dihydroporphyrin;4-naphthalen-1-ylbutanoic acid (PubChem CID 174843793) has the molecular formula C34H28N4O2 and a molecular weight of 524.62 g/mol. Its IUPAC name is 21,22-dihydroporphyrin;4-naphthalen-1-ylbutanoic acid.
| Compound Name | 21,22-dihydroporphyrin;4-naphthalen-1-ylbutanoic acid |
|---|---|
| PubChem CID | 174843793 |
| Molecular Formula | C34H28N4O2 |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 524.22 |
| IUPAC Name | 21,22-dihydroporphyrin;4-naphthalen-1-ylbutanoic acid |
| SMILES | C1=Cc2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3.O=C(O)CCCc1cccc2ccccc12 |
| InChI | InChI=1S/C20H14N4.C14H14O2/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;15-14(16)10-4-8-12-7-3-6-11-5-1-2-9-13(11)12/h1-12,21-22H;1-3,5-7,9H,4,8,10H2,(H,15,16)/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-; |
| InChIKey | UCVHHBBVIPOXKI-QDJBTJTOSA-N |
| XLogP | 7.90 |
| TPSA | 94.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |