C23H22N2O6S — CID 71819017
3-[[(5Z)-5-[[4-(2-methoxy-2-oxoethoxy)phenyl]methylidene]-4-oxo-3-propan-2-yl-1,3-thiazolidin-2-ylidene]amino]benzoic acid (PubChem CID 71819017) has the molecular formula C23H22N2O6S and a molecular weight of 454.50 g/mol. Its IUPAC name is 3-[[(5Z)-5-[[4-(2-methoxy-2-oxoethoxy)phenyl]methylidene]-4-oxo-3-propan-2-yl-1,3-thiazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 3-[[(5Z)-5-[[4-(2-methoxy-2-oxoethoxy)phenyl]methylidene]-4-oxo-3-propan-2-yl-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 71819017 |
| Molecular Formula | C23H22N2O6S |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 3-[[(5Z)-5-[[4-(2-methoxy-2-oxoethoxy)phenyl]methylidene]-4-oxo-3-propan-2-yl-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
| SMILES | COC(=O)COc1ccc(/C=C2\S/C(=N\c3cccc(C(=O)O)c3)N(C(C)C)C2=O)cc1 |
| InChI | InChI=1S/C23H22N2O6S/c1-14(2)25-21(27)19(11-15-7-9-18(10-8-15)31-13-20(26)30-3)32-23(25)24-17-6-4-5-16(12-17)22(28)29/h4-12,14H,13H2,1-3H3,(H,28,29)/b19-11-,24-23- |
| InChIKey | UKHFZPJYZRORPH-VXDNNOFKSA-N |
| XLogP | 3.95 |
| TPSA | 105.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|