C17H16FN5O2 — CID 71821031
N-(4-ethoxyphenyl)-5-(2-fluoroanilino)-2H-triazole-4-carboxamide (PubChem CID 71821031) has the molecular formula C17H16FN5O2 and a molecular weight of 341.35 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-5-(2-fluoroanilino)-2H-triazole-4-carboxamide.
| Compound Name | N-(4-ethoxyphenyl)-5-(2-fluoroanilino)-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 71821031 |
| Molecular Formula | C17H16FN5O2 |
| Molecular Weight | 341.35 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | N-(4-ethoxyphenyl)-5-(2-fluoroanilino)-2H-triazole-4-carboxamide |
| SMILES | CCOc1ccc(NC(=O)c2n[nH]nc2Nc2ccccc2F)cc1 |
| InChI | InChI=1S/C17H16FN5O2/c1-2-25-12-9-7-11(8-10-12)19-17(24)15-16(22-23-21-15)20-14-6-4-3-5-13(14)18/h3-10H,2H2,1H3,(H,19,24)(H2,20,21,22,23) |
| InChIKey | OQRJDPFFWJEJFN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |