C12H12N2S — CID 718211
4-ethyl-2-methyl-[1,3]thiazolo[5,4-b]indole (PubChem CID 718211) has the molecular formula C12H12N2S and a molecular weight of 216.31 g/mol. Its IUPAC name is 4-ethyl-2-methyl-[1,3]thiazolo[5,4-b]indole.
| Compound Name | 4-ethyl-2-methyl-[1,3]thiazolo[5,4-b]indole |
|---|---|
| PubChem CID | 718211 |
| Molecular Formula | C12H12N2S |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 4-ethyl-2-methyl-[1,3]thiazolo[5,4-b]indole |
| SMILES | CCn1c2ccccc2c2nc(C)sc21 |
| InChI | InChI=1S/C12H12N2S/c1-3-14-10-7-5-4-6-9(10)11-12(14)15-8(2)13-11/h4-7H,3H2,1-2H3 |
| InChIKey | CCPUHTCDTVZJDK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |