About 4-ethyl-2-methyl-[1,3]thiazolo[5,4-b]indole
4-ethyl-2-methyl-[1,3]thiazolo[5,4-b]indole (PubChem CID 718211) has the molecular formula C12H12N2S
and a molecular weight of 216.31 g/mol. Its IUPAC name is 4-ethyl-2-methyl-[1,3]thiazolo[5,4-b]indole.
Molecular Properties
| Compound Name | 4-ethyl-2-methyl-[1,3]thiazolo[5,4-b]indole |
| PubChem CID | 718211 |
| Molecular Formula | C12H12N2S |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 4-ethyl-2-methyl-[1,3]thiazolo[5,4-b]indole |
| SMILES | CCn1c2ccccc2c2nc(C)sc21 |
| InChI | InChI=1S/C12H12N2S/c1-3-14-10-7-5-4-6-9(10)11-12(14)15-8(2)13-11/h4-7H,3H2,1-2H3 |
| InChIKey | CCPUHTCDTVZJDK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-ethyl-2-methyl-[1,3]thiazolo[5,4-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2-methyl-[1,3]thiazolo[5,4-b]indole?
The IUPAC name of 4-ethyl-2-methyl-[1,3]thiazolo[5,4-b]indole (CID 718211) is 4-ethyl-2-methyl-[1,3]thiazolo[5,4-b]indole.
What is the SMILES notation for 4-ethyl-2-methyl-[1,3]thiazolo[5,4-b]indole?
The canonical SMILES for 4-ethyl-2-methyl-[1,3]thiazolo[5,4-b]indole is CCn1c2ccccc2c2nc(C)sc21.
What is the InChIKey of 4-ethyl-2-methyl-[1,3]thiazolo[5,4-b]indole?
The InChIKey is CCPUHTCDTVZJDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2S/c1-3-14-10-7-5-4-6-9(10)11-12(14)15-8(2)13-11/h4-7H,3H2,1-2H3.
What are the key properties of 4-ethyl-2-methyl-[1,3]thiazolo[5,4-b]indole?
4-ethyl-2-methyl-[1,3]thiazolo[5,4-b]indole has a molecular weight of 216.31 g/mol, XLogP of 3.58, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2-methyl-[1,3]thiazolo[5,4-b]indole is sourced from PubChem (CID 718211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).