C24H27Cl2N3O3S — CID 71821187
4,6-dichloro-N-(2,4-dimethylphenyl)-10-(3-methoxypropyl)-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide (PubChem CID 71821187) has the molecular formula C24H27Cl2N3O3S and a molecular weight of 508.47 g/mol. Its IUPAC name is 4,6-dichloro-N-(2,4-dimethylphenyl)-10-(3-methoxypropyl)-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide.
| Compound Name | 4,6-dichloro-N-(2,4-dimethylphenyl)-10-(3-methoxypropyl)-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide |
|---|---|
| PubChem CID | 71821187 |
| Molecular Formula | C24H27Cl2N3O3S |
| Molecular Weight | 508.47 g/mol |
| Exact Mass | 507.12 |
| IUPAC Name | 4,6-dichloro-N-(2,4-dimethylphenyl)-10-(3-methoxypropyl)-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide |
| SMILES | COCCCN1C(=S)NC2c3cc(Cl)cc(Cl)c3OC1(C)C2C(=O)Nc1ccc(C)cc1C |
| InChI | InChI=1S/C24H27Cl2N3O3S/c1-13-6-7-18(14(2)10-13)27-22(30)19-20-16-11-15(25)12-17(26)21(16)32-24(19,3)29(23(33)28-20)8-5-9-31-4/h6-7,10-12,19-20H,5,8-9H2,1-4H3,(H,27,30)(H,28,33) |
| InChIKey | BUAKBUREXQMIFM-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.47 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|