C20H20ClN3O2 — CID 71824226
5-(3-chloro-4-ethoxyphenyl)-N-[(3-methylphenyl)methyl]-1H-pyrazole-4-carboxamide (PubChem CID 71824226) has the molecular formula C20H20ClN3O2 and a molecular weight of 369.85 g/mol. Its IUPAC name is 5-(3-chloro-4-ethoxyphenyl)-N-[(3-methylphenyl)methyl]-1H-pyrazole-4-carboxamide.
| Compound Name | 5-(3-chloro-4-ethoxyphenyl)-N-[(3-methylphenyl)methyl]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 71824226 |
| Molecular Formula | C20H20ClN3O2 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 5-(3-chloro-4-ethoxyphenyl)-N-[(3-methylphenyl)methyl]-1H-pyrazole-4-carboxamide |
| SMILES | CCOc1ccc(-c2[nH]ncc2C(=O)NCc2cccc(C)c2)cc1Cl |
| InChI | InChI=1S/C20H20ClN3O2/c1-3-26-18-8-7-15(10-17(18)21)19-16(12-23-24-19)20(25)22-11-14-6-4-5-13(2)9-14/h4-10,12H,3,11H2,1-2H3,(H,22,25)(H,23,24) |
| InChIKey | NPJXJAXJLIZSKU-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |