C21H16N4O5S — CID 71827024
N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-2-[(3S)-2,5-dioxo-3,4-dihydro-1H-1,4-benzodiazepin-3-yl]acetamide (PubChem CID 71827024) has the molecular formula C21H16N4O5S and a molecular weight of 436.45 g/mol. Its IUPAC name is N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-2-[(3S)-2,5-dioxo-3,4-dihydro-1H-1,4-benzodiazepin-3-yl]acetamide.
| Compound Name | N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-2-[(3S)-2,5-dioxo-3,4-dihydro-1H-1,4-benzodiazepin-3-yl]acetamide |
|---|---|
| PubChem CID | 71827024 |
| Molecular Formula | C21H16N4O5S |
| Molecular Weight | 436.45 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-2-[(3S)-2,5-dioxo-3,4-dihydro-1H-1,4-benzodiazepin-3-yl]acetamide |
| SMILES | O=C(C[C@@H]1NC(=O)c2ccccc2NC1=O)Nc1nc(-c2ccc3c(c2)OCO3)cs1 |
| InChI | InChI=1S/C21H16N4O5S/c26-18(8-14-20(28)22-13-4-2-1-3-12(13)19(27)23-14)25-21-24-15(9-31-21)11-5-6-16-17(7-11)30-10-29-16/h1-7,9,14H,8,10H2,(H,22,28)(H,23,27)(H,24,25,26)/t14-/m0/s1 |
| InChIKey | SKDUEZUTJOXQBI-AWEZNQCLSA-N |
| XLogP | 2.62 |
| TPSA | 118.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |