C17H16N2O4 — CID 7182744
N-[(1S)-1-[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]ethyl]-1-(3-nitrophenyl)methanimine (PubChem CID 7182744) has the molecular formula C17H16N2O4 and a molecular weight of 312.33 g/mol. Its IUPAC name is N-[(1S)-1-[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]ethyl]-1-(3-nitrophenyl)methanimine.
| Compound Name | N-[(1S)-1-[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]ethyl]-1-(3-nitrophenyl)methanimine |
|---|---|
| PubChem CID | 7182744 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | N-[(1S)-1-[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]ethyl]-1-(3-nitrophenyl)methanimine |
| SMILES | C[C@H](/N=C/c1cccc([N+](=O)[O-])c1)[C@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C17H16N2O4/c1-12(17-11-22-15-7-2-3-8-16(15)23-17)18-10-13-5-4-6-14(9-13)19(20)21/h2-10,12,17H,11H2,1H3/b18-10+/t12-,17+/m0/s1 |
| InChIKey | HAHZFCSYJIIQEB-HIQWFDKSSA-N |
| XLogP | 3.24 |
| TPSA | 73.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|