About 4-[[(1S)-1-[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]ethyl]iminomethyl]phenol
4-[[(1S)-1-[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]ethyl]iminomethyl]phenol (PubChem CID 870958) has the molecular formula C17H17NO3
and a molecular weight of 283.33 g/mol. Its IUPAC name is 4-[[(1S)-1-[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]ethyl]iminomethyl]phenol.
Molecular Properties
| Compound Name | 4-[[(1S)-1-[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]ethyl]iminomethyl]phenol |
| PubChem CID | 870958 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 4-[[(1S)-1-[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]ethyl]iminomethyl]phenol |
| SMILES | C[C@H](/N=C/c1ccc(O)cc1)[C@@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C17H17NO3/c1-12(18-10-13-6-8-14(19)9-7-13)17-11-20-15-4-2-3-5-16(15)21-17/h2-10,12,17,19H,11H2,1H3/b18-10+/t12-,17-/m0/s1 |
| InChIKey | SFECSRDBATWEHZ-BXZUDYATSA-N |
| XLogP | 3.04 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[[(1S)-1-[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]ethyl]iminomethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(1S)-1-[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]ethyl]iminomethyl]phenol?
The IUPAC name of 4-[[(1S)-1-[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]ethyl]iminomethyl]phenol (CID 870958) is 4-[[(1S)-1-[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]ethyl]iminomethyl]phenol.
What is the SMILES notation for 4-[[(1S)-1-[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]ethyl]iminomethyl]phenol?
The canonical SMILES for 4-[[(1S)-1-[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]ethyl]iminomethyl]phenol is C[C@H](/N=C/c1ccc(O)cc1)[C@@H]1COc2ccccc2O1.
What is the InChIKey of 4-[[(1S)-1-[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]ethyl]iminomethyl]phenol?
The InChIKey is SFECSRDBATWEHZ-BXZUDYATSA-N. The full InChI is InChI=1S/C17H17NO3/c1-12(18-10-13-6-8-14(19)9-7-13)17-11-20-15-4-2-3-5-16(15)21-17/h2-10,12,17,19H,11H2,1H3/b18-10+/t12-,17-/m0/s1.
What are the key properties of 4-[[(1S)-1-[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]ethyl]iminomethyl]phenol?
4-[[(1S)-1-[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]ethyl]iminomethyl]phenol has a molecular weight of 283.33 g/mol, XLogP of 3.04, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(1S)-1-[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]ethyl]iminomethyl]phenol is sourced from PubChem (CID 870958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).