C15H20N4O3 — CID 71827851
N-[3-(dimethylamino)propyl]-2-(4-nitroindol-1-yl)acetamide (PubChem CID 71827851) has the molecular formula C15H20N4O3 and a molecular weight of 304.35 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-2-(4-nitroindol-1-yl)acetamide.
| Compound Name | N-[3-(dimethylamino)propyl]-2-(4-nitroindol-1-yl)acetamide |
|---|---|
| PubChem CID | 71827851 |
| Molecular Formula | C15H20N4O3 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-2-(4-nitroindol-1-yl)acetamide |
| SMILES | CN(C)CCCNC(=O)Cn1ccc2c([N+](=O)[O-])cccc21 |
| InChI | InChI=1S/C15H20N4O3/c1-17(2)9-4-8-16-15(20)11-18-10-7-12-13(18)5-3-6-14(12)19(21)22/h3,5-7,10H,4,8-9,11H2,1-2H3,(H,16,20) |
| InChIKey | XSIPDGJUBOXBLC-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 80.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|