C24H18FNO5 — CID 71830426
N-(2-fluorophenyl)-2-[[3-(3-methoxybenzoyl)-1-benzofuran-5-yl]oxy]acetamide (PubChem CID 71830426) has the molecular formula C24H18FNO5 and a molecular weight of 419.41 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-[[3-(3-methoxybenzoyl)-1-benzofuran-5-yl]oxy]acetamide.
| Compound Name | N-(2-fluorophenyl)-2-[[3-(3-methoxybenzoyl)-1-benzofuran-5-yl]oxy]acetamide |
|---|---|
| PubChem CID | 71830426 |
| Molecular Formula | C24H18FNO5 |
| Molecular Weight | 419.41 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | N-(2-fluorophenyl)-2-[[3-(3-methoxybenzoyl)-1-benzofuran-5-yl]oxy]acetamide |
| SMILES | COc1cccc(C(=O)c2coc3ccc(OCC(=O)Nc4ccccc4F)cc23)c1 |
| InChI | InChI=1S/C24H18FNO5/c1-29-16-6-4-5-15(11-16)24(28)19-13-31-22-10-9-17(12-18(19)22)30-14-23(27)26-21-8-3-2-7-20(21)25/h2-13H,14H2,1H3,(H,26,27) |
| InChIKey | LEMRBIBCBFTUEZ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.41 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |