C18H16ClN3O3 — CID 71832192
N-[(4-chlorophenyl)methylideneamino]-2,2-dimethyl-3-oxo-4H-1,4-benzoxazine-6-carboxamide (PubChem CID 71832192) has the molecular formula C18H16ClN3O3 and a molecular weight of 357.80 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methylideneamino]-2,2-dimethyl-3-oxo-4H-1,4-benzoxazine-6-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methylideneamino]-2,2-dimethyl-3-oxo-4H-1,4-benzoxazine-6-carboxamide |
|---|---|
| PubChem CID | 71832192 |
| Molecular Formula | C18H16ClN3O3 |
| Molecular Weight | 357.80 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | N-[(4-chlorophenyl)methylideneamino]-2,2-dimethyl-3-oxo-4H-1,4-benzoxazine-6-carboxamide |
| SMILES | CC1(C)Oc2ccc(C(=O)NN=Cc3ccc(Cl)cc3)cc2NC1=O |
| InChI | InChI=1S/C18H16ClN3O3/c1-18(2)17(24)21-14-9-12(5-8-15(14)25-18)16(23)22-20-10-11-3-6-13(19)7-4-11/h3-10H,1-2H3,(H,21,24)(H,22,23) |
| InChIKey | KOJWPXGYVOIZIJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.80 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|