C28H26N4O3S — CID 71834764
3-[3-[[1-(2,3-dimethylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonitrile (PubChem CID 71834764) has the molecular formula C28H26N4O3S and a molecular weight of 498.61 g/mol. Its IUPAC name is 3-[3-[[1-(2,3-dimethylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonitrile.
| Compound Name | 3-[3-[[1-(2,3-dimethylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonitrile |
|---|---|
| PubChem CID | 71834764 |
| Molecular Formula | C28H26N4O3S |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | 3-[3-[[1-(2,3-dimethylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonitrile |
| SMILES | Cc1cccc(N2C(=O)NC(=O)C(=Cc3cc(C)n(-c4c(C#N)sc5c4CCCC5)c3C)C2=O)c1C |
| InChI | InChI=1S/C28H26N4O3S/c1-15-8-7-10-22(17(15)3)32-27(34)21(26(33)30-28(32)35)13-19-12-16(2)31(18(19)4)25-20-9-5-6-11-23(20)36-24(25)14-29/h7-8,10,12-13H,5-6,9,11H2,1-4H3,(H,30,33,35) |
| InChIKey | ZUWNMHCFJSNHIQ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|