C23H18Br2N2O — CID 71835512
2-amino-4-(2-bromophenyl)-8-[(2-bromophenyl)methylidene]-4,5,6,7-tetrahydrochromene-3-carbonitrile (PubChem CID 71835512) has the molecular formula C23H18Br2N2O and a molecular weight of 498.22 g/mol. Its IUPAC name is 2-amino-4-(2-bromophenyl)-8-[(2-bromophenyl)methylidene]-4,5,6,7-tetrahydrochromene-3-carbonitrile.
| Compound Name | 2-amino-4-(2-bromophenyl)-8-[(2-bromophenyl)methylidene]-4,5,6,7-tetrahydrochromene-3-carbonitrile |
|---|---|
| PubChem CID | 71835512 |
| Molecular Formula | C23H18Br2N2O |
| Molecular Weight | 498.22 g/mol |
| Exact Mass | 495.98 |
| IUPAC Name | 2-amino-4-(2-bromophenyl)-8-[(2-bromophenyl)methylidene]-4,5,6,7-tetrahydrochromene-3-carbonitrile |
| SMILES | N#CC1=C(N)OC2=C(CCCC2=Cc2ccccc2Br)C1c1ccccc1Br |
| InChI | InChI=1S/C23H18Br2N2O/c24-19-10-3-1-6-14(19)12-15-7-5-9-17-21(16-8-2-4-11-20(16)25)18(13-26)23(27)28-22(15)17/h1-4,6,8,10-12,21H,5,7,9,27H2 |
| InChIKey | SYQZYJOPPGHJHC-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.22 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dhp_amino_CN_A(13)', 'substructure': 'N/A'} |
|---|