C27H26Cl2N2O — CID 40823247
(4R,6S,8E)-2-amino-6-tert-butyl-4-(2-chlorophenyl)-8-[(2-chlorophenyl)methylidene]-4,5,6,7-tetrahydrochromene-3-carbonitrile (PubChem CID 40823247) has the molecular formula C27H26Cl2N2O and a molecular weight of 465.42 g/mol. Its IUPAC name is (4R,6S,8E)-2-amino-6-tert-butyl-4-(2-chlorophenyl)-8-[(2-chlorophenyl)methylidene]-4,5,6,7-tetrahydrochromene-3-carbonitrile.
| Compound Name | (4R,6S,8E)-2-amino-6-tert-butyl-4-(2-chlorophenyl)-8-[(2-chlorophenyl)methylidene]-4,5,6,7-tetrahydrochromene-3-carbonitrile |
|---|---|
| PubChem CID | 40823247 |
| Molecular Formula | C27H26Cl2N2O |
| Molecular Weight | 465.42 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | (4R,6S,8E)-2-amino-6-tert-butyl-4-(2-chlorophenyl)-8-[(2-chlorophenyl)methylidene]-4,5,6,7-tetrahydrochromene-3-carbonitrile |
| SMILES | CC(C)(C)[C@@H]1CC2=C(OC(N)=C(C#N)[C@@H]2c2ccccc2Cl)/C(=C/c2ccccc2Cl)C1 |
| InChI | InChI=1S/C27H26Cl2N2O/c1-27(2,3)18-13-17(12-16-8-4-6-10-22(16)28)25-20(14-18)24(21(15-30)26(31)32-25)19-9-5-7-11-23(19)29/h4-12,18,24H,13-14,31H2,1-3H3/b17-12+/t18-,24+/m0/s1 |
| InChIKey | DCDCHBSBVCLMAN-KZCHATAMSA-N |
| XLogP | 7.59 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.42 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dhp_amino_CN_A(13)', 'substructure': 'N/A'} |
|---|