C17H29N3O2 — CID 71836650
2-N-cyclohexyl-4-N-methyl-2-azaspiro[4.4]nonane-2,4-dicarboxamide (PubChem CID 71836650) has the molecular formula C17H29N3O2 and a molecular weight of 307.44 g/mol. Its IUPAC name is 2-N-cyclohexyl-4-N-methyl-2-azaspiro[4.4]nonane-2,4-dicarboxamide.
| Compound Name | 2-N-cyclohexyl-4-N-methyl-2-azaspiro[4.4]nonane-2,4-dicarboxamide |
|---|---|
| PubChem CID | 71836650 |
| Molecular Formula | C17H29N3O2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | 2-N-cyclohexyl-4-N-methyl-2-azaspiro[4.4]nonane-2,4-dicarboxamide |
| SMILES | CNC(=O)C1CN(C(=O)NC2CCCCC2)CC12CCCC2 |
| InChI | InChI=1S/C17H29N3O2/c1-18-15(21)14-11-20(12-17(14)9-5-6-10-17)16(22)19-13-7-3-2-4-8-13/h13-14H,2-12H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | KFPSXNDQLLBULQ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |