C16H21FN2O2 — CID 71839103
N-[1-(4-fluorophenyl)-2-oxopyrrolidin-3-yl]-3,3-dimethylbutanamide (PubChem CID 71839103) has the molecular formula C16H21FN2O2 and a molecular weight of 292.35 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)-2-oxopyrrolidin-3-yl]-3,3-dimethylbutanamide.
| Compound Name | N-[1-(4-fluorophenyl)-2-oxopyrrolidin-3-yl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 71839103 |
| Molecular Formula | C16H21FN2O2 |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | N-[1-(4-fluorophenyl)-2-oxopyrrolidin-3-yl]-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)CC(=O)NC1CCN(c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C16H21FN2O2/c1-16(2,3)10-14(20)18-13-8-9-19(15(13)21)12-6-4-11(17)5-7-12/h4-7,13H,8-10H2,1-3H3,(H,18,20) |
| InChIKey | QJJIADJIWAJANL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |