C14H12BrN3OS — CID 71844437
N-[(4-bromothiophen-2-yl)methyl]-1-methylbenzimidazole-5-carboxamide (PubChem CID 71844437) has the molecular formula C14H12BrN3OS and a molecular weight of 350.24 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-1-methylbenzimidazole-5-carboxamide.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-1-methylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 71844437 |
| Molecular Formula | C14H12BrN3OS |
| Molecular Weight | 350.24 g/mol |
| Exact Mass | 348.99 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-1-methylbenzimidazole-5-carboxamide |
| SMILES | Cn1cnc2cc(C(=O)NCc3cc(Br)cs3)ccc21 |
| InChI | InChI=1S/C14H12BrN3OS/c1-18-8-17-12-4-9(2-3-13(12)18)14(19)16-6-11-5-10(15)7-20-11/h2-5,7-8H,6H2,1H3,(H,16,19) |
| InChIKey | YHYWYJHEXPTSTB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.24 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |