C12H8BrF3N2OS — CID 47250304
N-[(4-bromothiophen-2-yl)methyl]-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 47250304) has the molecular formula C12H8BrF3N2OS and a molecular weight of 365.17 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-6-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-6-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 47250304 |
| Molecular Formula | C12H8BrF3N2OS |
| Molecular Weight | 365.17 g/mol |
| Exact Mass | 363.95 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | O=C(NCc1cc(Br)cs1)c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C12H8BrF3N2OS/c13-8-3-9(20-6-8)5-18-11(19)7-1-2-10(17-4-7)12(14,15)16/h1-4,6H,5H2,(H,18,19) |
| InChIKey | ZDVYDLSKFANOGE-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.17 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |