C13H10BrF2NOS2 — CID 47250267
N-[(4-bromothiophen-2-yl)methyl]-4-(difluoromethylsulfanyl)benzamide (PubChem CID 47250267) has the molecular formula C13H10BrF2NOS2 and a molecular weight of 378.26 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-4-(difluoromethylsulfanyl)benzamide.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-4-(difluoromethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 47250267 |
| Molecular Formula | C13H10BrF2NOS2 |
| Molecular Weight | 378.26 g/mol |
| Exact Mass | 376.94 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-4-(difluoromethylsulfanyl)benzamide |
| SMILES | O=C(NCc1cc(Br)cs1)c1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C13H10BrF2NOS2/c14-9-5-11(19-7-9)6-17-12(18)8-1-3-10(4-2-8)20-13(15)16/h1-5,7,13H,6H2,(H,17,18) |
| InChIKey | UDIDXZNKUBJXLD-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.26 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |