C23H23NO4 — CID 71844842
methyl 3-hydroxy-4-[(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)methyl]naphthalene-2-carboxylate (PubChem CID 71844842) has the molecular formula C23H23NO4 and a molecular weight of 377.44 g/mol. Its IUPAC name is methyl 3-hydroxy-4-[(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)methyl]naphthalene-2-carboxylate.
| Compound Name | methyl 3-hydroxy-4-[(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)methyl]naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 71844842 |
| Molecular Formula | C23H23NO4 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | methyl 3-hydroxy-4-[(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)methyl]naphthalene-2-carboxylate |
| SMILES | COC(=O)c1cc2ccccc2c(CN2CCCc3cc(OC)ccc32)c1O |
| InChI | InChI=1S/C23H23NO4/c1-27-17-9-10-21-16(12-17)7-5-11-24(21)14-20-18-8-4-3-6-15(18)13-19(22(20)25)23(26)28-2/h3-4,6,8-10,12-13,25H,5,7,11,14H2,1-2H3 |
| InChIKey | PAGDUTTUHORBIO-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|