benzyl 3-[(1-methylpyrazol-4-yl)amino]benzoate

C18H17N3O2 — CID 71846936

IUPACbenzyl 3-[(1-methylpyrazol-4-yl)amino]benzoate
SMILESCn1cc(Nc2cccc(C(=O)OCc3ccccc3)c2)cn1
InChIInChI=1S/C18H17N3O2/c1-21-12-17(11-19-21)20-16-9-5-8-15(10-16)18(22)23-13-14-6-3-2-4-7-14/h2-12,20H,13H2,1H3
InChIKeyPNQKSUGUOCSTFF-UHFFFAOYSA-N
MW307.35 g/mol
LogP3.52
Rot. Bonds5

About benzyl 3-[(1-methylpyrazol-4-yl)amino]benzoate

benzyl 3-[(1-methylpyrazol-4-yl)amino]benzoate (PubChem CID 71846936) has the molecular formula C18H17N3O2 and a molecular weight of 307.35 g/mol. Its IUPAC name is benzyl 3-[(1-methylpyrazol-4-yl)amino]benzoate.

Molecular Properties

Compound Namebenzyl 3-[(1-methylpyrazol-4-yl)amino]benzoate
PubChem CID71846936
Molecular FormulaC18H17N3O2
Molecular Weight307.35 g/mol
Exact Mass307.13
IUPAC Namebenzyl 3-[(1-methylpyrazol-4-yl)amino]benzoate
SMILESCn1cc(Nc2cccc(C(=O)OCc3ccccc3)c2)cn1
InChIInChI=1S/C18H17N3O2/c1-21-12-17(11-19-21)20-16-9-5-8-15(10-16)18(22)23-13-14-6-3-2-4-7-14/h2-12,20H,13H2,1H3
InChIKeyPNQKSUGUOCSTFF-UHFFFAOYSA-N
XLogP3.52
TPSA56.15 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500307.35
LogP ≤ 53.52
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze benzyl 3-[(1-methylpyrazol-4-yl)amino]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 3-[(1-methylpyrazol-4-yl)amino]benzoate?
The IUPAC name of benzyl 3-[(1-methylpyrazol-4-yl)amino]benzoate (CID 71846936) is benzyl 3-[(1-methylpyrazol-4-yl)amino]benzoate.
What is the SMILES notation for benzyl 3-[(1-methylpyrazol-4-yl)amino]benzoate?
The canonical SMILES for benzyl 3-[(1-methylpyrazol-4-yl)amino]benzoate is Cn1cc(Nc2cccc(C(=O)OCc3ccccc3)c2)cn1.
What is the InChIKey of benzyl 3-[(1-methylpyrazol-4-yl)amino]benzoate?
The InChIKey is PNQKSUGUOCSTFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3O2/c1-21-12-17(11-19-21)20-16-9-5-8-15(10-16)18(22)23-13-14-6-3-2-4-7-14/h2-12,20H,13H2,1H3.
What are the key properties of benzyl 3-[(1-methylpyrazol-4-yl)amino]benzoate?
benzyl 3-[(1-methylpyrazol-4-yl)amino]benzoate has a molecular weight of 307.35 g/mol, XLogP of 3.52, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 3-[(1-methylpyrazol-4-yl)amino]benzoate is sourced from PubChem (CID 71846936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).