C13H21FN2O3S — CID 71847521
2-fluoro-1-methoxy-4-[1-[[methyl(propyl)sulfamoyl]amino]ethyl]benzene (PubChem CID 71847521) has the molecular formula C13H21FN2O3S and a molecular weight of 304.39 g/mol. Its IUPAC name is 2-fluoro-1-methoxy-4-[1-[[methyl(propyl)sulfamoyl]amino]ethyl]benzene.
| Compound Name | 2-fluoro-1-methoxy-4-[1-[[methyl(propyl)sulfamoyl]amino]ethyl]benzene |
|---|---|
| PubChem CID | 71847521 |
| Molecular Formula | C13H21FN2O3S |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 2-fluoro-1-methoxy-4-[1-[[methyl(propyl)sulfamoyl]amino]ethyl]benzene |
| SMILES | CCCN(C)S(=O)(=O)NC(C)c1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C13H21FN2O3S/c1-5-8-16(3)20(17,18)15-10(2)11-6-7-13(19-4)12(14)9-11/h6-7,9-10,15H,5,8H2,1-4H3 |
| InChIKey | RKZXYJUWFGSZDL-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |