C19H20ClN3O4S — CID 71848055
N-[4-[2-(2-chloroacetyl)-3-(3-methoxyphenyl)-3,4-dihydropyrazol-5-yl]phenyl]methanesulfonamide (PubChem CID 71848055) has the molecular formula C19H20ClN3O4S and a molecular weight of 421.91 g/mol. Its IUPAC name is N-[4-[2-(2-chloroacetyl)-3-(3-methoxyphenyl)-3,4-dihydropyrazol-5-yl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[2-(2-chloroacetyl)-3-(3-methoxyphenyl)-3,4-dihydropyrazol-5-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 71848055 |
| Molecular Formula | C19H20ClN3O4S |
| Molecular Weight | 421.91 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | N-[4-[2-(2-chloroacetyl)-3-(3-methoxyphenyl)-3,4-dihydropyrazol-5-yl]phenyl]methanesulfonamide |
| SMILES | COc1cccc(C2CC(c3ccc(NS(C)(=O)=O)cc3)=NN2C(=O)CCl)c1 |
| InChI | InChI=1S/C19H20ClN3O4S/c1-27-16-5-3-4-14(10-16)18-11-17(21-23(18)19(24)12-20)13-6-8-15(9-7-13)22-28(2,25)26/h3-10,18,22H,11-12H2,1-2H3 |
| InChIKey | VXJLVYOLQXUOKQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.91 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|