C18H33N5O3 — CID 71848258
tert-butyl N-[2-ethyl-2-(3-imidazol-1-ylpropylcarbamoylamino)butyl]carbamate (PubChem CID 71848258) has the molecular formula C18H33N5O3 and a molecular weight of 367.49 g/mol. Its IUPAC name is tert-butyl N-[2-ethyl-2-(3-imidazol-1-ylpropylcarbamoylamino)butyl]carbamate.
| Compound Name | tert-butyl N-[2-ethyl-2-(3-imidazol-1-ylpropylcarbamoylamino)butyl]carbamate |
|---|---|
| PubChem CID | 71848258 |
| Molecular Formula | C18H33N5O3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.26 |
| IUPAC Name | tert-butyl N-[2-ethyl-2-(3-imidazol-1-ylpropylcarbamoylamino)butyl]carbamate |
| SMILES | CCC(CC)(CNC(=O)OC(C)(C)C)NC(=O)NCCCn1ccnc1 |
| InChI | InChI=1S/C18H33N5O3/c1-6-18(7-2,13-21-16(25)26-17(3,4)5)22-15(24)20-9-8-11-23-12-10-19-14-23/h10,12,14H,6-9,11,13H2,1-5H3,(H,21,25)(H2,20,22,24) |
| InChIKey | LKAPPXKDWYQXCV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 97.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|