C17H23N5O3 — CID 56827057
tert-butyl N-[4-(2-imidazol-1-ylethylcarbamoylamino)phenyl]carbamate (PubChem CID 56827057) has the molecular formula C17H23N5O3 and a molecular weight of 345.40 g/mol. Its IUPAC name is tert-butyl N-[4-(2-imidazol-1-ylethylcarbamoylamino)phenyl]carbamate.
| Compound Name | tert-butyl N-[4-(2-imidazol-1-ylethylcarbamoylamino)phenyl]carbamate |
|---|---|
| PubChem CID | 56827057 |
| Molecular Formula | C17H23N5O3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | tert-butyl N-[4-(2-imidazol-1-ylethylcarbamoylamino)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(NC(=O)NCCn2ccnc2)cc1 |
| InChI | InChI=1S/C17H23N5O3/c1-17(2,3)25-16(24)21-14-6-4-13(5-7-14)20-15(23)19-9-11-22-10-8-18-12-22/h4-8,10,12H,9,11H2,1-3H3,(H,21,24)(H2,19,20,23) |
| InChIKey | GPCKIACOFRZBSY-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 97.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |