C21H30ClN3O3 — CID 71849114
N-(3-chloro-4-piperidin-1-ylphenyl)-4-(2-methyl-1,3-dioxolan-2-yl)piperidine-1-carboxamide (PubChem CID 71849114) has the molecular formula C21H30ClN3O3 and a molecular weight of 407.94 g/mol. Its IUPAC name is N-(3-chloro-4-piperidin-1-ylphenyl)-4-(2-methyl-1,3-dioxolan-2-yl)piperidine-1-carboxamide.
| Compound Name | N-(3-chloro-4-piperidin-1-ylphenyl)-4-(2-methyl-1,3-dioxolan-2-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 71849114 |
| Molecular Formula | C21H30ClN3O3 |
| Molecular Weight | 407.94 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | N-(3-chloro-4-piperidin-1-ylphenyl)-4-(2-methyl-1,3-dioxolan-2-yl)piperidine-1-carboxamide |
| SMILES | CC1(C2CCN(C(=O)Nc3ccc(N4CCCCC4)c(Cl)c3)CC2)OCCO1 |
| InChI | InChI=1S/C21H30ClN3O3/c1-21(27-13-14-28-21)16-7-11-25(12-8-16)20(26)23-17-5-6-19(18(22)15-17)24-9-3-2-4-10-24/h5-6,15-16H,2-4,7-14H2,1H3,(H,23,26) |
| InChIKey | JBGUPXVWWPIYEG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.94 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|