C17H16F3N3O3S — CID 71849401
N-[1-(pyridine-2-carbonyl)pyrrolidin-3-yl]-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 71849401) has the molecular formula C17H16F3N3O3S and a molecular weight of 399.39 g/mol. Its IUPAC name is N-[1-(pyridine-2-carbonyl)pyrrolidin-3-yl]-2-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[1-(pyridine-2-carbonyl)pyrrolidin-3-yl]-2-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 71849401 |
| Molecular Formula | C17H16F3N3O3S |
| Molecular Weight | 399.39 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | N-[1-(pyridine-2-carbonyl)pyrrolidin-3-yl]-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=C(c1ccccn1)N1CCC(NS(=O)(=O)c2ccccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C17H16F3N3O3S/c18-17(19,20)13-5-1-2-7-15(13)27(25,26)22-12-8-10-23(11-12)16(24)14-6-3-4-9-21-14/h1-7,9,12,22H,8,10-11H2 |
| InChIKey | AMUSGOJCYNEEIU-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.39 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |