C10H22N2O3S — CID 71849598
2-[tert-butyl(2-ethylsulfonylethyl)amino]acetamide (PubChem CID 71849598) has the molecular formula C10H22N2O3S and a molecular weight of 250.36 g/mol. Its IUPAC name is 2-[tert-butyl(2-ethylsulfonylethyl)amino]acetamide.
| Compound Name | 2-[tert-butyl(2-ethylsulfonylethyl)amino]acetamide |
|---|---|
| PubChem CID | 71849598 |
| Molecular Formula | C10H22N2O3S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 2-[tert-butyl(2-ethylsulfonylethyl)amino]acetamide |
| SMILES | CCS(=O)(=O)CCN(CC(N)=O)C(C)(C)C |
| InChI | InChI=1S/C10H22N2O3S/c1-5-16(14,15)7-6-12(8-9(11)13)10(2,3)4/h5-8H2,1-4H3,(H2,11,13) |
| InChIKey | LLOIWBCWVFJYBA-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |