C10H22N2O4S — CID 113238914
3-[2-[(1-hydroxy-2-methylpropan-2-yl)-methylamino]ethylsulfonyl]propanamide (PubChem CID 113238914) has the molecular formula C10H22N2O4S and a molecular weight of 266.36 g/mol. Its IUPAC name is 3-[2-[(1-hydroxy-2-methylpropan-2-yl)-methylamino]ethylsulfonyl]propanamide.
| Compound Name | 3-[2-[(1-hydroxy-2-methylpropan-2-yl)-methylamino]ethylsulfonyl]propanamide |
|---|---|
| PubChem CID | 113238914 |
| Molecular Formula | C10H22N2O4S |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 3-[2-[(1-hydroxy-2-methylpropan-2-yl)-methylamino]ethylsulfonyl]propanamide |
| SMILES | CN(CCS(=O)(=O)CCC(N)=O)C(C)(C)CO |
| InChI | InChI=1S/C10H22N2O4S/c1-10(2,8-13)12(3)5-7-17(15,16)6-4-9(11)14/h13H,4-8H2,1-3H3,(H2,11,14) |
| InChIKey | LTAVZMOQUNZNIG-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |