C10H19NO5S2 — CID 105354034
2-[2-(3-amino-3-oxopropyl)sulfonylethylsulfanyl]-3-methylbutanoic acid (PubChem CID 105354034) has the molecular formula C10H19NO5S2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 2-[2-(3-amino-3-oxopropyl)sulfonylethylsulfanyl]-3-methylbutanoic acid.
| Compound Name | 2-[2-(3-amino-3-oxopropyl)sulfonylethylsulfanyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 105354034 |
| Molecular Formula | C10H19NO5S2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 2-[2-(3-amino-3-oxopropyl)sulfonylethylsulfanyl]-3-methylbutanoic acid |
| SMILES | CC(C)C(SCCS(=O)(=O)CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C10H19NO5S2/c1-7(2)9(10(13)14)17-4-6-18(15,16)5-3-8(11)12/h7,9H,3-6H2,1-2H3,(H2,11,12)(H,13,14) |
| InChIKey | OLOGDAGLGPBTGO-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 114.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |