C8H17NO4S2 — CID 106725277
(2R)-2-amino-3-(2-propylsulfonylethylsulfanyl)propanoic acid (PubChem CID 106725277) has the molecular formula C8H17NO4S2 and a molecular weight of 255.36 g/mol. Its IUPAC name is (2R)-2-amino-3-(2-propylsulfonylethylsulfanyl)propanoic acid.
| Compound Name | (2R)-2-amino-3-(2-propylsulfonylethylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 106725277 |
| Molecular Formula | C8H17NO4S2 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | (2R)-2-amino-3-(2-propylsulfonylethylsulfanyl)propanoic acid |
| SMILES | CCCS(=O)(=O)CCSC[C@H](N)C(=O)O |
| InChI | InChI=1S/C8H17NO4S2/c1-2-4-15(12,13)5-3-14-6-7(9)8(10)11/h7H,2-6,9H2,1H3,(H,10,11)/t7-/m0/s1 |
| InChIKey | LCGFLBQBDUGLGC-ZETCQYMHSA-N |
| XLogP | -0.04 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|