C5H11NO5S2 — CID 25202009
(2R)-2-amino-3-(2-sulfoethylsulfanyl)propanoic acid (PubChem CID 25202009) has the molecular formula C5H11NO5S2 and a molecular weight of 229.28 g/mol. Its IUPAC name is (2R)-2-amino-3-(2-sulfoethylsulfanyl)propanoic acid.
| Compound Name | (2R)-2-amino-3-(2-sulfoethylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 25202009 |
| Molecular Formula | C5H11NO5S2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.01 |
| IUPAC Name | (2R)-2-amino-3-(2-sulfoethylsulfanyl)propanoic acid |
| SMILES | N[C@@H](CSCCS(=O)(=O)O)C(=O)O |
| InChI | InChI=1S/C5H11NO5S2/c6-4(5(7)8)3-12-1-2-13(9,10)11/h4H,1-3,6H2,(H,7,8)(H,9,10,11)/t4-/m0/s1 |
| InChIKey | BVNVKGQFBDNXFU-BYPYZUCNSA-N |
| XLogP | -0.98 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|