C7H16N2O5S3 — CID 175609780
2-amino-3-[(2-amino-4-sulfobutyl)disulfanyl]propanoic acid (PubChem CID 175609780) has the molecular formula C7H16N2O5S3 and a molecular weight of 304.42 g/mol. Its IUPAC name is 2-amino-3-[(2-amino-4-sulfobutyl)disulfanyl]propanoic acid.
| Compound Name | 2-amino-3-[(2-amino-4-sulfobutyl)disulfanyl]propanoic acid |
|---|---|
| PubChem CID | 175609780 |
| Molecular Formula | C7H16N2O5S3 |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | 2-amino-3-[(2-amino-4-sulfobutyl)disulfanyl]propanoic acid |
| SMILES | NC(CCS(=O)(=O)O)CSSCC(N)C(=O)O |
| InChI | InChI=1S/C7H16N2O5S3/c8-5(1-2-17(12,13)14)3-15-16-4-6(9)7(10)11/h5-6H,1-4,8-9H2,(H,10,11)(H,12,13,14) |
| InChIKey | LRRMHBGMASTARV-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 143.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|