C8H20N2O6S4 — CID 24851355
(3S)-3-amino-4-[[(2S)-2-amino-4-sulfobutyl]disulfanyl]butane-1-sulfonic acid (PubChem CID 24851355) has the molecular formula C8H20N2O6S4 and a molecular weight of 368.52 g/mol. Its IUPAC name is (3S)-3-amino-4-[[(2S)-2-amino-4-sulfobutyl]disulfanyl]butane-1-sulfonic acid.
| Compound Name | (3S)-3-amino-4-[[(2S)-2-amino-4-sulfobutyl]disulfanyl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 24851355 |
| Molecular Formula | C8H20N2O6S4 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | (3S)-3-amino-4-[[(2S)-2-amino-4-sulfobutyl]disulfanyl]butane-1-sulfonic acid |
| SMILES | N[C@@H](CCS(=O)(=O)O)CSSC[C@@H](N)CCS(=O)(=O)O |
| InChI | InChI=1S/C8H20N2O6S4/c9-7(1-3-19(11,12)13)5-17-18-6-8(10)2-4-20(14,15)16/h7-8H,1-6,9-10H2,(H,11,12,13)(H,14,15,16)/t7-,8-/m0/s1 |
| InChIKey | HJPXZXVKLGEMGP-YUMQZZPRSA-N |
| XLogP | -0.42 |
| TPSA | 160.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|