C5H10N2O3S3 — CID 141134522
4-amino-3-carbamothioyl-4-sulfanylidenebutane-1-sulfonic acid (PubChem CID 141134522) has the molecular formula C5H10N2O3S3 and a molecular weight of 242.35 g/mol. Its IUPAC name is 4-amino-3-carbamothioyl-4-sulfanylidenebutane-1-sulfonic acid.
| Compound Name | 4-amino-3-carbamothioyl-4-sulfanylidenebutane-1-sulfonic acid |
|---|---|
| PubChem CID | 141134522 |
| Molecular Formula | C5H10N2O3S3 |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 241.99 |
| IUPAC Name | 4-amino-3-carbamothioyl-4-sulfanylidenebutane-1-sulfonic acid |
| SMILES | NC(=S)C(CCS(=O)(=O)O)C(N)=S |
| InChI | InChI=1S/C5H10N2O3S3/c6-4(11)3(5(7)12)1-2-13(8,9)10/h3H,1-2H2,(H2,6,11)(H2,7,12)(H,8,9,10) |
| InChIKey | VQRKVZHNYCWXKC-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|