C14H28N2O4S2 — CID 10428114
(5S)-5-amino-6-[[(2S)-2-amino-5-carboxyhexyl]disulfanyl]-2-methylhexanoic acid (PubChem CID 10428114) has the molecular formula C14H28N2O4S2 and a molecular weight of 352.52 g/mol. Its IUPAC name is (5S)-5-amino-6-[[(2S)-2-amino-5-carboxyhexyl]disulfanyl]-2-methylhexanoic acid.
| Compound Name | (5S)-5-amino-6-[[(2S)-2-amino-5-carboxyhexyl]disulfanyl]-2-methylhexanoic acid |
|---|---|
| PubChem CID | 10428114 |
| Molecular Formula | C14H28N2O4S2 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | (5S)-5-amino-6-[[(2S)-2-amino-5-carboxyhexyl]disulfanyl]-2-methylhexanoic acid |
| SMILES | CC(CC[C@H](N)CSSC[C@@H](N)CCC(C)C(=O)O)C(=O)O |
| InChI | InChI=1S/C14H28N2O4S2/c1-9(13(17)18)3-5-11(15)7-21-22-8-12(16)6-4-10(2)14(19)20/h9-12H,3-8,15-16H2,1-2H3,(H,17,18)(H,19,20)/t9?,10?,11-,12-/m0/s1 |
| InChIKey | ZEZBYWINEVMAFH-QQFIATSDSA-N |
| XLogP | 2.02 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|