C10H20N2O5S — CID 43631516
2-[2-(3-amino-3-oxopropyl)sulfonylethylamino]pentanoic acid (PubChem CID 43631516) has the molecular formula C10H20N2O5S and a molecular weight of 280.35 g/mol. Its IUPAC name is 2-[2-(3-amino-3-oxopropyl)sulfonylethylamino]pentanoic acid.
| Compound Name | 2-[2-(3-amino-3-oxopropyl)sulfonylethylamino]pentanoic acid |
|---|---|
| PubChem CID | 43631516 |
| Molecular Formula | C10H20N2O5S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 2-[2-(3-amino-3-oxopropyl)sulfonylethylamino]pentanoic acid |
| SMILES | CCCC(NCCS(=O)(=O)CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C10H20N2O5S/c1-2-3-8(10(14)15)12-5-7-18(16,17)6-4-9(11)13/h8,12H,2-7H2,1H3,(H2,11,13)(H,14,15) |
| InChIKey | JNCXOQKUXYZKAR-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |