C19H32N2O3S — CID 25395916
3-[2-[[(1S)-1-[4-[(2S)-butan-2-yl]phenyl]-2-methylpropyl]amino]ethylsulfonyl]propanamide (PubChem CID 25395916) has the molecular formula C19H32N2O3S and a molecular weight of 368.54 g/mol. Its IUPAC name is 3-[2-[[(1S)-1-[4-[(2S)-butan-2-yl]phenyl]-2-methylpropyl]amino]ethylsulfonyl]propanamide.
| Compound Name | 3-[2-[[(1S)-1-[4-[(2S)-butan-2-yl]phenyl]-2-methylpropyl]amino]ethylsulfonyl]propanamide |
|---|---|
| PubChem CID | 25395916 |
| Molecular Formula | C19H32N2O3S |
| Molecular Weight | 368.54 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 3-[2-[[(1S)-1-[4-[(2S)-butan-2-yl]phenyl]-2-methylpropyl]amino]ethylsulfonyl]propanamide |
| SMILES | CC[C@H](C)c1ccc([C@@H](NCCS(=O)(=O)CCC(N)=O)C(C)C)cc1 |
| InChI | InChI=1S/C19H32N2O3S/c1-5-15(4)16-6-8-17(9-7-16)19(14(2)3)21-11-13-25(23,24)12-10-18(20)22/h6-9,14-15,19,21H,5,10-13H2,1-4H3,(H2,20,22)/t15-,19-/m0/s1 |
| InChIKey | AMFZUOBEUNSXHP-KXBFYZLASA-N |
| XLogP | 2.78 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.54 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |