C6H16N2O2S — CID 164644258
2-methyl-2-[methyl-(methylsulfonimidoyl)amino]propan-1-ol (PubChem CID 164644258) has the molecular formula C6H16N2O2S and a molecular weight of 180.27 g/mol. Its IUPAC name is 2-methyl-2-[methyl-(methylsulfonimidoyl)amino]propan-1-ol.
| Compound Name | 2-methyl-2-[methyl-(methylsulfonimidoyl)amino]propan-1-ol |
|---|---|
| PubChem CID | 164644258 |
| Molecular Formula | C6H16N2O2S |
| Molecular Weight | 180.27 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 2-methyl-2-[methyl-(methylsulfonimidoyl)amino]propan-1-ol |
| SMILES | [H]N=S(C)(=O)N(C)C(C)(C)CO |
| InChI | InChI=1S/C6H16N2O2S/c1-6(2,5-9)8(3)11(4,7)10/h7,9H,5H2,1-4H3 |
| InChIKey | JTPXVHZDBMAJDY-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 64.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.27 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |