C14H12Br2N4O3 — CID 71849761
N-(2,5-dibromo-3-pyridinyl)-3-(2-nitroanilino)propanamide (PubChem CID 71849761) has the molecular formula C14H12Br2N4O3 and a molecular weight of 444.08 g/mol. Its IUPAC name is N-(2,5-dibromo-3-pyridinyl)-3-(2-nitroanilino)propanamide.
| Compound Name | N-(2,5-dibromo-3-pyridinyl)-3-(2-nitroanilino)propanamide |
|---|---|
| PubChem CID | 71849761 |
| Molecular Formula | C14H12Br2N4O3 |
| Molecular Weight | 444.08 g/mol |
| Exact Mass | 441.93 |
| IUPAC Name | N-(2,5-dibromo-3-pyridinyl)-3-(2-nitroanilino)propanamide |
| SMILES | O=C(CCNc1ccccc1[N+](=O)[O-])Nc1cc(Br)cnc1Br |
| InChI | InChI=1S/C14H12Br2N4O3/c15-9-7-11(14(16)18-8-9)19-13(21)5-6-17-10-3-1-2-4-12(10)20(22)23/h1-4,7-8,17H,5-6H2,(H,19,21) |
| InChIKey | LTGMVBJPDVUIAF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.08 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|