C13H11N3O3 — CID 71852535
4-cyano-N-(2-hydroxy-5-methoxyphenyl)-1H-pyrrole-2-carboxamide (PubChem CID 71852535) has the molecular formula C13H11N3O3 and a molecular weight of 257.25 g/mol. Its IUPAC name is 4-cyano-N-(2-hydroxy-5-methoxyphenyl)-1H-pyrrole-2-carboxamide.
| Compound Name | 4-cyano-N-(2-hydroxy-5-methoxyphenyl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 71852535 |
| Molecular Formula | C13H11N3O3 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 4-cyano-N-(2-hydroxy-5-methoxyphenyl)-1H-pyrrole-2-carboxamide |
| SMILES | COc1ccc(O)c(NC(=O)c2cc(C#N)c[nH]2)c1 |
| InChI | InChI=1S/C13H11N3O3/c1-19-9-2-3-12(17)10(5-9)16-13(18)11-4-8(6-14)7-15-11/h2-5,7,15,17H,1H3,(H,16,18) |
| InChIKey | ITJOPHGSRCUBAX-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|