C14H15F2N3O — CID 71854684
1-cyclopropyl-1-(2,2-difluoroethyl)-3-(1H-indol-4-yl)urea (PubChem CID 71854684) has the molecular formula C14H15F2N3O and a molecular weight of 279.29 g/mol. Its IUPAC name is 1-cyclopropyl-1-(2,2-difluoroethyl)-3-(1H-indol-4-yl)urea.
| Compound Name | 1-cyclopropyl-1-(2,2-difluoroethyl)-3-(1H-indol-4-yl)urea |
|---|---|
| PubChem CID | 71854684 |
| Molecular Formula | C14H15F2N3O |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 1-cyclopropyl-1-(2,2-difluoroethyl)-3-(1H-indol-4-yl)urea |
| SMILES | O=C(Nc1cccc2[nH]ccc12)N(CC(F)F)C1CC1 |
| InChI | InChI=1S/C14H15F2N3O/c15-13(16)8-19(9-4-5-9)14(20)18-12-3-1-2-11-10(12)6-7-17-11/h1-3,6-7,9,13,17H,4-5,8H2,(H,18,20) |
| InChIKey | AQLUWSPMQGSCPG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |