C20H17F2NO2S — CID 71854734
N-benzyl-3,5-difluoro-N-(2-hydroxy-2-thiophen-3-ylethyl)benzamide (PubChem CID 71854734) has the molecular formula C20H17F2NO2S and a molecular weight of 373.42 g/mol. Its IUPAC name is N-benzyl-3,5-difluoro-N-(2-hydroxy-2-thiophen-3-ylethyl)benzamide.
| Compound Name | N-benzyl-3,5-difluoro-N-(2-hydroxy-2-thiophen-3-ylethyl)benzamide |
|---|---|
| PubChem CID | 71854734 |
| Molecular Formula | C20H17F2NO2S |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | N-benzyl-3,5-difluoro-N-(2-hydroxy-2-thiophen-3-ylethyl)benzamide |
| SMILES | O=C(c1cc(F)cc(F)c1)N(Cc1ccccc1)CC(O)c1ccsc1 |
| InChI | InChI=1S/C20H17F2NO2S/c21-17-8-16(9-18(22)10-17)20(25)23(11-14-4-2-1-3-5-14)12-19(24)15-6-7-26-13-15/h1-10,13,19,24H,11-12H2 |
| InChIKey | DPAXUKHTOVFHJV-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |