C20H33N3O2 — CID 71855462
2-methyl-1-morpholin-4-yl-3-[[1-(1-phenylethyl)pyrrolidin-3-yl]amino]propan-2-ol (PubChem CID 71855462) has the molecular formula C20H33N3O2 and a molecular weight of 347.50 g/mol. Its IUPAC name is 2-methyl-1-morpholin-4-yl-3-[[1-(1-phenylethyl)pyrrolidin-3-yl]amino]propan-2-ol.
| Compound Name | 2-methyl-1-morpholin-4-yl-3-[[1-(1-phenylethyl)pyrrolidin-3-yl]amino]propan-2-ol |
|---|---|
| PubChem CID | 71855462 |
| Molecular Formula | C20H33N3O2 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.26 |
| IUPAC Name | 2-methyl-1-morpholin-4-yl-3-[[1-(1-phenylethyl)pyrrolidin-3-yl]amino]propan-2-ol |
| SMILES | CC(c1ccccc1)N1CCC(NCC(C)(O)CN2CCOCC2)C1 |
| InChI | InChI=1S/C20H33N3O2/c1-17(18-6-4-3-5-7-18)23-9-8-19(14-23)21-15-20(2,24)16-22-10-12-25-13-11-22/h3-7,17,19,21,24H,8-16H2,1-2H3 |
| InChIKey | ZXMRLUCFMUHXBO-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 47.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |