C20H30N2O2 — CID 71855541
[2-(3-cyclopentylpropylamino)phenyl]-(3-hydroxypiperidin-1-yl)methanone (PubChem CID 71855541) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is [2-(3-cyclopentylpropylamino)phenyl]-(3-hydroxypiperidin-1-yl)methanone.
| Compound Name | [2-(3-cyclopentylpropylamino)phenyl]-(3-hydroxypiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 71855541 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | [2-(3-cyclopentylpropylamino)phenyl]-(3-hydroxypiperidin-1-yl)methanone |
| SMILES | O=C(c1ccccc1NCCCC1CCCC1)N1CCCC(O)C1 |
| InChI | InChI=1S/C20H30N2O2/c23-17-10-6-14-22(15-17)20(24)18-11-3-4-12-19(18)21-13-5-9-16-7-1-2-8-16/h3-4,11-12,16-17,21,23H,1-2,5-10,13-15H2 |
| InChIKey | YGOVNDVDFZAPEW-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|