C22H27N3O4 — CID 51957235
2-[2-[(3R)-3-hydroxypiperidine-1-carbonyl]anilino]-N-(2-methoxy-5-methylphenyl)acetamide (PubChem CID 51957235) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is 2-[2-[(3R)-3-hydroxypiperidine-1-carbonyl]anilino]-N-(2-methoxy-5-methylphenyl)acetamide.
| Compound Name | 2-[2-[(3R)-3-hydroxypiperidine-1-carbonyl]anilino]-N-(2-methoxy-5-methylphenyl)acetamide |
|---|---|
| PubChem CID | 51957235 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 2-[2-[(3R)-3-hydroxypiperidine-1-carbonyl]anilino]-N-(2-methoxy-5-methylphenyl)acetamide |
| SMILES | COc1ccc(C)cc1NC(=O)CNc1ccccc1C(=O)N1CCC[C@@H](O)C1 |
| InChI | InChI=1S/C22H27N3O4/c1-15-9-10-20(29-2)19(12-15)24-21(27)13-23-18-8-4-3-7-17(18)22(28)25-11-5-6-16(26)14-25/h3-4,7-10,12,16,23,26H,5-6,11,13-14H2,1-2H3,(H,24,27)/t16-/m1/s1 |
| InChIKey | UTSFDOQWSZTAJY-MRXNPFEDSA-N |
| XLogP | 2.65 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |