C15H20FN5O — CID 71856033
1-[2-(dimethylamino)ethyl]-3-[1-(2-fluorophenyl)pyrazol-4-yl]-1-methylurea (PubChem CID 71856033) has the molecular formula C15H20FN5O and a molecular weight of 305.36 g/mol. Its IUPAC name is 1-[2-(dimethylamino)ethyl]-3-[1-(2-fluorophenyl)pyrazol-4-yl]-1-methylurea.
| Compound Name | 1-[2-(dimethylamino)ethyl]-3-[1-(2-fluorophenyl)pyrazol-4-yl]-1-methylurea |
|---|---|
| PubChem CID | 71856033 |
| Molecular Formula | C15H20FN5O |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 1-[2-(dimethylamino)ethyl]-3-[1-(2-fluorophenyl)pyrazol-4-yl]-1-methylurea |
| SMILES | CN(C)CCN(C)C(=O)Nc1cnn(-c2ccccc2F)c1 |
| InChI | InChI=1S/C15H20FN5O/c1-19(2)8-9-20(3)15(22)18-12-10-17-21(11-12)14-7-5-4-6-13(14)16/h4-7,10-11H,8-9H2,1-3H3,(H,18,22) |
| InChIKey | SJWTVAGDTXLMMT-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |