C17H13F3N4O — CID 2812808
1-phenyl-3-[4-[3-(trifluoromethyl)pyrazol-1-yl]phenyl]urea (PubChem CID 2812808) has the molecular formula C17H13F3N4O and a molecular weight of 346.31 g/mol. Its IUPAC name is 1-phenyl-3-[4-[3-(trifluoromethyl)pyrazol-1-yl]phenyl]urea.
| Compound Name | 1-phenyl-3-[4-[3-(trifluoromethyl)pyrazol-1-yl]phenyl]urea |
|---|---|
| PubChem CID | 2812808 |
| Molecular Formula | C17H13F3N4O |
| Molecular Weight | 346.31 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 1-phenyl-3-[4-[3-(trifluoromethyl)pyrazol-1-yl]phenyl]urea |
| SMILES | O=C(Nc1ccccc1)Nc1ccc(-n2ccc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C17H13F3N4O/c18-17(19,20)15-10-11-24(23-15)14-8-6-13(7-9-14)22-16(25)21-12-4-2-1-3-5-12/h1-11H,(H2,21,22,25) |
| InChIKey | HSBABDCPWMXWQN-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.31 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |