C15H22N4O — CID 71856322
N-(7-methyl-[1,2,4]triazolo[4,3-a]pyridin-3-yl)octanamide (PubChem CID 71856322) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is N-(7-methyl-[1,2,4]triazolo[4,3-a]pyridin-3-yl)octanamide.
| Compound Name | N-(7-methyl-[1,2,4]triazolo[4,3-a]pyridin-3-yl)octanamide |
|---|---|
| PubChem CID | 71856322 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | N-(7-methyl-[1,2,4]triazolo[4,3-a]pyridin-3-yl)octanamide |
| SMILES | CCCCCCCC(=O)Nc1nnc2cc(C)ccn12 |
| InChI | InChI=1S/C15H22N4O/c1-3-4-5-6-7-8-14(20)16-15-18-17-13-11-12(2)9-10-19(13)15/h9-11H,3-8H2,1-2H3,(H,16,18,20) |
| InChIKey | RMOUFIDUZQPATO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|